C18H21N3O4 — CID 108519873
N-(3,4-diethoxyphenyl)-N'-(6-methyl-2-pyridinyl)oxamide (PubChem CID 108519873) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-N'-(6-methyl-2-pyridinyl)oxamide.
| Compound Name | N-(3,4-diethoxyphenyl)-N'-(6-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 108519873 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-N'-(6-methyl-2-pyridinyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)Nc2cccc(C)n2)cc1OCC |
| InChI | InChI=1S/C18H21N3O4/c1-4-24-14-10-9-13(11-15(14)25-5-2)20-17(22)18(23)21-16-8-6-7-12(3)19-16/h6-11H,4-5H2,1-3H3,(H,20,22)(H,19,21,23) |
| InChIKey | FZOAZJODRYYLTB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|