C27H33N5O5 — CID 141452215
5-[(4-amino-2,5-diethoxyphenyl)methylcarbamoylamino]-2-ethoxy-N-(6-methyl-2-pyridinyl)benzamide (PubChem CID 141452215) has the molecular formula C27H33N5O5 and a molecular weight of 507.59 g/mol. Its IUPAC name is 5-[(4-amino-2,5-diethoxyphenyl)methylcarbamoylamino]-2-ethoxy-N-(6-methyl-2-pyridinyl)benzamide.
| Compound Name | 5-[(4-amino-2,5-diethoxyphenyl)methylcarbamoylamino]-2-ethoxy-N-(6-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 141452215 |
| Molecular Formula | C27H33N5O5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 5-[(4-amino-2,5-diethoxyphenyl)methylcarbamoylamino]-2-ethoxy-N-(6-methyl-2-pyridinyl)benzamide |
| SMILES | CCOc1cc(CNC(=O)Nc2ccc(OCC)c(C(=O)Nc3cccc(C)n3)c2)c(OCC)cc1N |
| InChI | InChI=1S/C27H33N5O5/c1-5-35-22-12-11-19(14-20(22)26(33)32-25-10-8-9-17(4)30-25)31-27(34)29-16-18-13-24(37-7-3)21(28)15-23(18)36-6-2/h8-15H,5-7,16,28H2,1-4H3,(H2,29,31,34)(H,30,32,33) |
| InChIKey | YELUAVJZYSHGCG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|