C24H32N4O7 — CID 141452117
5-[(2,5-diethoxy-4-nitrophenyl)methylcarbamoylamino]-2-ethoxy-N-propylbenzamide (PubChem CID 141452117) has the molecular formula C24H32N4O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is 5-[(2,5-diethoxy-4-nitrophenyl)methylcarbamoylamino]-2-ethoxy-N-propylbenzamide.
| Compound Name | 5-[(2,5-diethoxy-4-nitrophenyl)methylcarbamoylamino]-2-ethoxy-N-propylbenzamide |
|---|---|
| PubChem CID | 141452117 |
| Molecular Formula | C24H32N4O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 5-[(2,5-diethoxy-4-nitrophenyl)methylcarbamoylamino]-2-ethoxy-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)NCc2cc(OCC)c([N+](=O)[O-])cc2OCC)ccc1OCC |
| InChI | InChI=1S/C24H32N4O7/c1-5-11-25-23(29)18-13-17(9-10-20(18)33-6-2)27-24(30)26-15-16-12-22(35-8-4)19(28(31)32)14-21(16)34-7-3/h9-10,12-14H,5-8,11,15H2,1-4H3,(H,25,29)(H2,26,27,30) |
| InChIKey | MKTJXRFLSKPEJI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|