C18H22BrN3O3 — CID 141452136
1-[(4-amino-2,5-diethoxyphenyl)methyl]-3-(3-bromophenyl)urea (PubChem CID 141452136) has the molecular formula C18H22BrN3O3 and a molecular weight of 408.30 g/mol. Its IUPAC name is 1-[(4-amino-2,5-diethoxyphenyl)methyl]-3-(3-bromophenyl)urea.
| Compound Name | 1-[(4-amino-2,5-diethoxyphenyl)methyl]-3-(3-bromophenyl)urea |
|---|---|
| PubChem CID | 141452136 |
| Molecular Formula | C18H22BrN3O3 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 1-[(4-amino-2,5-diethoxyphenyl)methyl]-3-(3-bromophenyl)urea |
| SMILES | CCOc1cc(CNC(=O)Nc2cccc(Br)c2)c(OCC)cc1N |
| InChI | InChI=1S/C18H22BrN3O3/c1-3-24-16-10-15(20)17(25-4-2)8-12(16)11-21-18(23)22-14-7-5-6-13(19)9-14/h5-10H,3-4,11,20H2,1-2H3,(H2,21,22,23) |
| InChIKey | DRVQEZDTILPPDK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|