C10H11BrN2O3 — CID 108870222
methyl 2-[(3-bromophenyl)carbamoylamino]acetate (PubChem CID 108870222) has the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. Its IUPAC name is methyl 2-[(3-bromophenyl)carbamoylamino]acetate.
| Compound Name | methyl 2-[(3-bromophenyl)carbamoylamino]acetate |
|---|---|
| PubChem CID | 108870222 |
| Molecular Formula | C10H11BrN2O3 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | methyl 2-[(3-bromophenyl)carbamoylamino]acetate |
| SMILES | COC(=O)CNC(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C10H11BrN2O3/c1-16-9(14)6-12-10(15)13-8-4-2-3-7(11)5-8/h2-5H,6H2,1H3,(H2,12,13,15) |
| InChIKey | RKXMYHFQQMVLRR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |