C15H21BrN2O3 — CID 107473884
2-[[(3-bromophenyl)carbamoylamino]methyl]-4,4-dimethylpentanoic acid (PubChem CID 107473884) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is 2-[[(3-bromophenyl)carbamoylamino]methyl]-4,4-dimethylpentanoic acid.
| Compound Name | 2-[[(3-bromophenyl)carbamoylamino]methyl]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 107473884 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[[(3-bromophenyl)carbamoylamino]methyl]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(CNC(=O)Nc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C15H21BrN2O3/c1-15(2,3)8-10(13(19)20)9-17-14(21)18-12-6-4-5-11(16)7-12/h4-7,10H,8-9H2,1-3H3,(H,19,20)(H2,17,18,21) |
| InChIKey | JWTSXUXPQTXVPA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |