C11H15BrN2O2 — CID 111336733
1-(3-bromophenyl)-3-(3-hydroxybutyl)urea (PubChem CID 111336733) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(3-hydroxybutyl)urea.
| Compound Name | 1-(3-bromophenyl)-3-(3-hydroxybutyl)urea |
|---|---|
| PubChem CID | 111336733 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1-(3-bromophenyl)-3-(3-hydroxybutyl)urea |
| SMILES | CC(O)CCNC(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C11H15BrN2O2/c1-8(15)5-6-13-11(16)14-10-4-2-3-9(12)7-10/h2-4,7-8,15H,5-6H2,1H3,(H2,13,14,16) |
| InChIKey | RWXXVMHWJAWUKQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |