About N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide
N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide (PubChem CID 108511634) has the molecular formula C26H21N3O3
and a molecular weight of 423.47 g/mol. Its IUPAC name is N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide.
Molecular Properties
| Compound Name | N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide |
| PubChem CID | 108511634 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide |
| SMILES | Nc1ccc(N(C(=O)C(=O)Nc2ccc(Oc3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O3/c27-19-11-15-22(16-12-19)29(21-7-3-1-4-8-21)26(31)25(30)28-20-13-17-24(18-14-20)32-23-9-5-2-6-10-23/h1-18H,27H2,(H,28,30) |
| InChIKey | BPMPSMCAKCHZKV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide?
The IUPAC name of N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide (CID 108511634) is N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide.
What is the SMILES notation for N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide?
The canonical SMILES for N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide is Nc1ccc(N(C(=O)C(=O)Nc2ccc(Oc3ccccc3)cc2)c2ccccc2)cc1.
What is the InChIKey of N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide?
The InChIKey is BPMPSMCAKCHZKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N3O3/c27-19-11-15-22(16-12-19)29(21-7-3-1-4-8-21)26(31)25(30)28-20-13-17-24(18-14-20)32-23-9-5-2-6-10-23/h1-18H,27H2,(H,28,30).
What are the key properties of N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide?
N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide has a molecular weight of 423.47 g/mol, XLogP of 5.36, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-aminophenyl)-N-(4-phenoxyphenyl)-N'-phenyloxamide is sourced from PubChem (CID 108511634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).