C32H52N4O2 — CID 159801982
N-(3-aminophenyl)acetamide;N-[3-(dioctylamino)phenyl]acetamide (PubChem CID 159801982) has the molecular formula C32H52N4O2 and a molecular weight of 524.79 g/mol. Its IUPAC name is N-(3-aminophenyl)acetamide;N-[3-(dioctylamino)phenyl]acetamide.
| Compound Name | N-(3-aminophenyl)acetamide;N-[3-(dioctylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 159801982 |
| Molecular Formula | C32H52N4O2 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.41 |
| IUPAC Name | N-(3-aminophenyl)acetamide;N-[3-(dioctylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(N)c1.CCCCCCCCN(CCCCCCCC)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C24H42N2O.C8H10N2O/c1-4-6-8-10-12-14-19-26(20-15-13-11-9-7-5-2)24-18-16-17-23(21-24)25-22(3)27;1-6(11)10-8-4-2-3-7(9)5-8/h16-18,21H,4-15,19-20H2,1-3H3,(H,25,27);2-5H,9H2,1H3,(H,10,11) |
| InChIKey | NJXIZTJHBCMTGT-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|