C17H21N3O2 — CID 154358903
2-(N-ethylanilino)ethyl N-(3-aminophenyl)carbamate (PubChem CID 154358903) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(N-ethylanilino)ethyl N-(3-aminophenyl)carbamate.
| Compound Name | 2-(N-ethylanilino)ethyl N-(3-aminophenyl)carbamate |
|---|---|
| PubChem CID | 154358903 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-(N-ethylanilino)ethyl N-(3-aminophenyl)carbamate |
| SMILES | CCN(CCOC(=O)Nc1cccc(N)c1)c1ccccc1 |
| InChI | InChI=1S/C17H21N3O2/c1-2-20(16-9-4-3-5-10-16)11-12-22-17(21)19-15-8-6-7-14(18)13-15/h3-10,13H,2,11-12,18H2,1H3,(H,19,21) |
| InChIKey | RDRRPAXXSIDUBN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|