About 3-(dioctylamino)phenol
3-(dioctylamino)phenol (PubChem CID 15734569) has the molecular formula C22H39NO
and a molecular weight of 333.56 g/mol. Its IUPAC name is 3-(dioctylamino)phenol.
Molecular Properties
| Compound Name | 3-(dioctylamino)phenol |
| PubChem CID | 15734569 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | 3-(dioctylamino)phenol |
| SMILES | CCCCCCCCN(CCCCCCCC)c1cccc(O)c1 |
| InChI | InChI=1S/C22H39NO/c1-3-5-7-9-11-13-18-23(19-14-12-10-8-6-4-2)21-16-15-17-22(24)20-21/h15-17,20,24H,3-14,18-19H2,1-2H3 |
| InChIKey | DEESEDSYSBALFV-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(dioctylamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dioctylamino)phenol?
The IUPAC name of 3-(dioctylamino)phenol (CID 15734569) is 3-(dioctylamino)phenol.
What is the SMILES notation for 3-(dioctylamino)phenol?
The canonical SMILES for 3-(dioctylamino)phenol is CCCCCCCCN(CCCCCCCC)c1cccc(O)c1.
What is the InChIKey of 3-(dioctylamino)phenol?
The InChIKey is DEESEDSYSBALFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H39NO/c1-3-5-7-9-11-13-18-23(19-14-12-10-8-6-4-2)21-16-15-17-22(24)20-21/h15-17,20,24H,3-14,18-19H2,1-2H3.
What are the key properties of 3-(dioctylamino)phenol?
3-(dioctylamino)phenol has a molecular weight of 333.56 g/mol, XLogP of 6.92, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dioctylamino)phenol is sourced from PubChem (CID 15734569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).