C31H59NO — CID 174801839
N,N-dioctyloctan-1-amine;3-methylphenol (PubChem CID 174801839) has the molecular formula C31H59NO and a molecular weight of 461.82 g/mol. Its IUPAC name is N,N-dioctyloctan-1-amine;3-methylphenol.
| Compound Name | N,N-dioctyloctan-1-amine;3-methylphenol |
|---|---|
| PubChem CID | 174801839 |
| Molecular Formula | C31H59NO |
| Molecular Weight | 461.82 g/mol |
| Exact Mass | 461.46 |
| IUPAC Name | N,N-dioctyloctan-1-amine;3-methylphenol |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCCCCC.Cc1cccc(O)c1 |
| InChI | InChI=1S/C24H51N.C7H8O/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-6-3-2-4-7(8)5-6/h4-24H2,1-3H3;2-5,8H,1H3 |
| InChIKey | KFJMYVZGCIWBHP-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.82 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|