3-(dihexylamino)benzoic acid

C19H31NO2 — CID 139785875

IUPAC3-(dihexylamino)benzoic acid
SMILESCCCCCCN(CCCCCC)c1cccc(C(=O)O)c1
InChIInChI=1S/C19H31NO2/c1-3-5-7-9-14-20(15-10-8-6-4-2)18-13-11-12-17(16-18)19(21)22/h11-13,16H,3-10,14-15H2,1-2H3,(H,21,22)
InChIKeyCWRXNUXKHWSPFS-UHFFFAOYSA-N
MW305.46 g/mol
LogP5.35
Rot. Bonds12

About 3-(dihexylamino)benzoic acid

3-(dihexylamino)benzoic acid (PubChem CID 139785875) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 3-(dihexylamino)benzoic acid.

Molecular Properties

Compound Name3-(dihexylamino)benzoic acid
PubChem CID139785875
Molecular FormulaC19H31NO2
Molecular Weight305.46 g/mol
Exact Mass305.24
IUPAC Name3-(dihexylamino)benzoic acid
SMILESCCCCCCN(CCCCCC)c1cccc(C(=O)O)c1
InChIInChI=1S/C19H31NO2/c1-3-5-7-9-14-20(15-10-8-6-4-2)18-13-11-12-17(16-18)19(21)22/h11-13,16H,3-10,14-15H2,1-2H3,(H,21,22)
InChIKeyCWRXNUXKHWSPFS-UHFFFAOYSA-N
XLogP5.35
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds12
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500305.46
LogP ≤ 55.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-(dihexylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(dihexylamino)benzoic acid?
The IUPAC name of 3-(dihexylamino)benzoic acid (CID 139785875) is 3-(dihexylamino)benzoic acid.
What is the SMILES notation for 3-(dihexylamino)benzoic acid?
The canonical SMILES for 3-(dihexylamino)benzoic acid is CCCCCCN(CCCCCC)c1cccc(C(=O)O)c1.
What is the InChIKey of 3-(dihexylamino)benzoic acid?
The InChIKey is CWRXNUXKHWSPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NO2/c1-3-5-7-9-14-20(15-10-8-6-4-2)18-13-11-12-17(16-18)19(21)22/h11-13,16H,3-10,14-15H2,1-2H3,(H,21,22).
What are the key properties of 3-(dihexylamino)benzoic acid?
3-(dihexylamino)benzoic acid has a molecular weight of 305.46 g/mol, XLogP of 5.35, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dihexylamino)benzoic acid is sourced from PubChem (CID 139785875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).