C20H31NO2 — CID 59545235
3-[ethyl-[4-(4-methylcyclohexyl)butyl]amino]benzoic acid (PubChem CID 59545235) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 3-[ethyl-[4-(4-methylcyclohexyl)butyl]amino]benzoic acid.
| Compound Name | 3-[ethyl-[4-(4-methylcyclohexyl)butyl]amino]benzoic acid |
|---|---|
| PubChem CID | 59545235 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 3-[ethyl-[4-(4-methylcyclohexyl)butyl]amino]benzoic acid |
| SMILES | CCN(CCCCC1CCC(C)CC1)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H31NO2/c1-3-21(19-9-6-8-18(15-19)20(22)23)14-5-4-7-17-12-10-16(2)11-13-17/h6,8-9,15-17H,3-5,7,10-14H2,1-2H3,(H,22,23) |
| InChIKey | PHCZQIVLQGPMDV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|