C10H12NO4S- — CID 69305222
1-carboxy-3-[propyl(sulfinato)amino]benzene (PubChem CID 69305222) has the molecular formula C10H12NO4S- and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-carboxy-3-[propyl(sulfinato)amino]benzene.
| Compound Name | 1-carboxy-3-[propyl(sulfinato)amino]benzene |
|---|---|
| PubChem CID | 69305222 |
| Molecular Formula | C10H12NO4S- |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 1-carboxy-3-[propyl(sulfinato)amino]benzene |
| SMILES | CCCN(c1cccc(C(=O)O)c1)S(=O)[O-] |
| InChI | InChI=1S/C10H13NO4S/c1-2-6-11(16(14)15)9-5-3-4-8(7-9)10(12)13/h3-5,7H,2,6H2,1H3,(H,12,13)(H,14,15)/p-1 |
| InChIKey | FMAAEDYLWMIFCR-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|