C14H22NO3- — CID 54677139
3-carboxyphenolate;N,N-diethylpropan-1-amine (PubChem CID 54677139) has the molecular formula C14H22NO3- and a molecular weight of 252.33 g/mol. Its IUPAC name is 3-carboxyphenolate;N,N-diethylpropan-1-amine.
| Compound Name | 3-carboxyphenolate;N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 54677139 |
| Molecular Formula | C14H22NO3- |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 3-carboxyphenolate;N,N-diethylpropan-1-amine |
| SMILES | CCCN(CC)CC.O=C(O)c1cccc([O-])c1 |
| InChI | InChI=1S/C7H17N.C7H6O3/c1-4-7-8(5-2)6-3;8-6-3-1-2-5(4-6)7(9)10/h4-7H2,1-3H3;1-4,8H,(H,9,10)/p-1 |
| InChIKey | TWNUWXRAFUDGLY-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |