C24H18F2N3O5S- — CID 90932588
5-(3-carboxyphenyl)-3-[2,6-difluoro-3-[propyl(sulfinato)amino]benzoyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 90932588) has the molecular formula C24H18F2N3O5S- and a molecular weight of 498.49 g/mol. Its IUPAC name is 5-(3-carboxyphenyl)-3-[2,6-difluoro-3-[propyl(sulfinato)amino]benzoyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(3-carboxyphenyl)-3-[2,6-difluoro-3-[propyl(sulfinato)amino]benzoyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 90932588 |
| Molecular Formula | C24H18F2N3O5S- |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 5-(3-carboxyphenyl)-3-[2,6-difluoro-3-[propyl(sulfinato)amino]benzoyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCCN(c1ccc(F)c(C(=O)c2c[nH]c3ncc(-c4cccc(C(=O)O)c4)cc23)c1F)S(=O)[O-] |
| InChI | InChI=1S/C24H19F2N3O5S/c1-2-8-29(35(33)34)19-7-6-18(25)20(21(19)26)22(30)17-12-28-23-16(17)10-15(11-27-23)13-4-3-5-14(9-13)24(31)32/h3-7,9-12H,2,8H2,1H3,(H,27,28)(H,31,32)(H,33,34)/p-1 |
| InChIKey | RCWGYYYBEMUQFL-UHFFFAOYSA-M |
| XLogP | 4.45 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|