C23H19F2N4O5S2- — CID 91404875
3-[2,6-difluoro-3-[propyl(sulfinato)amino]benzoyl]-5-(4-sulfamoylphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 91404875) has the molecular formula C23H19F2N4O5S2- and a molecular weight of 533.56 g/mol. Its IUPAC name is 3-[2,6-difluoro-3-[propyl(sulfinato)amino]benzoyl]-5-(4-sulfamoylphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[2,6-difluoro-3-[propyl(sulfinato)amino]benzoyl]-5-(4-sulfamoylphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 91404875 |
| Molecular Formula | C23H19F2N4O5S2- |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | 3-[2,6-difluoro-3-[propyl(sulfinato)amino]benzoyl]-5-(4-sulfamoylphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCCN(c1ccc(F)c(C(=O)c2c[nH]c3ncc(-c4ccc(S(N)(=O)=O)cc4)cc23)c1F)S(=O)[O-] |
| InChI | InChI=1S/C23H20F2N4O5S2/c1-2-9-29(35(31)32)19-8-7-18(24)20(21(19)25)22(30)17-12-28-23-16(17)10-14(11-27-23)13-3-5-15(6-4-13)36(26,33)34/h3-8,10-12H,2,9H2,1H3,(H,27,28)(H,31,32)(H2,26,33,34)/p-1 |
| InChIKey | WTWSKMYSZDIWEI-UHFFFAOYSA-M |
| XLogP | 3.40 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|