C24H20N2O10S3 — CID 102323834
5-(4-aminophenoxy)-2-[4-(4-aminophenoxy)-2-sulfophenyl]sulfonylbenzenesulfonic acid (PubChem CID 102323834) has the molecular formula C24H20N2O10S3 and a molecular weight of 592.63 g/mol. Its IUPAC name is 5-(4-aminophenoxy)-2-[4-(4-aminophenoxy)-2-sulfophenyl]sulfonylbenzenesulfonic acid.
| Compound Name | 5-(4-aminophenoxy)-2-[4-(4-aminophenoxy)-2-sulfophenyl]sulfonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 102323834 |
| Molecular Formula | C24H20N2O10S3 |
| Molecular Weight | 592.63 g/mol |
| Exact Mass | 592.03 |
| IUPAC Name | 5-(4-aminophenoxy)-2-[4-(4-aminophenoxy)-2-sulfophenyl]sulfonylbenzenesulfonic acid |
| SMILES | Nc1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(N)cc4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C24H20N2O10S3/c25-15-1-5-17(6-2-15)35-19-9-11-21(23(13-19)38(29,30)31)37(27,28)22-12-10-20(14-24(22)39(32,33)34)36-18-7-3-16(26)4-8-18/h1-14H,25-26H2,(H,29,30,31)(H,32,33,34) |
| InChIKey | GBUMMQYYTHJYOP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 213.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|