C31H33NO11S3 — CID 123542595
2-[4-[4-[4-(2-aminopropan-2-yloxy)phenoxy]phenoxy]-2-sulfophenyl]sulfonyl-5-tert-butylbenzenesulfonic acid (PubChem CID 123542595) has the molecular formula C31H33NO11S3 and a molecular weight of 691.80 g/mol. Its IUPAC name is 2-[4-[4-[4-(2-aminopropan-2-yloxy)phenoxy]phenoxy]-2-sulfophenyl]sulfonyl-5-tert-butylbenzenesulfonic acid.
| Compound Name | 2-[4-[4-[4-(2-aminopropan-2-yloxy)phenoxy]phenoxy]-2-sulfophenyl]sulfonyl-5-tert-butylbenzenesulfonic acid |
|---|---|
| PubChem CID | 123542595 |
| Molecular Formula | C31H33NO11S3 |
| Molecular Weight | 691.80 g/mol |
| Exact Mass | 691.12 |
| IUPAC Name | 2-[4-[4-[4-(2-aminopropan-2-yloxy)phenoxy]phenoxy]-2-sulfophenyl]sulfonyl-5-tert-butylbenzenesulfonic acid |
| SMILES | CC(C)(N)Oc1ccc(Oc2ccc(Oc3ccc(S(=O)(=O)c4ccc(C(C)(C)C)cc4S(=O)(=O)O)c(S(=O)(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C31H33NO11S3/c1-30(2,3)20-6-16-26(28(18-20)45(35,36)37)44(33,34)27-17-15-25(19-29(27)46(38,39)40)42-23-9-7-21(8-10-23)41-22-11-13-24(14-12-22)43-31(4,5)32/h6-19H,32H2,1-5H3,(H,35,36,37)(H,38,39,40) |
| InChIKey | OBRRJYJJDWPHEX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 196.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.80 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|