C20H14F4N2O5 — CID 158475219
5-fluoro-1-methyl-2-nitro-3-phenylmethoxybenzene;1,3,5-trifluoro-2-nitrobenzene (PubChem CID 158475219) has the molecular formula C20H14F4N2O5 and a molecular weight of 438.33 g/mol. Its IUPAC name is 5-fluoro-1-methyl-2-nitro-3-phenylmethoxybenzene;1,3,5-trifluoro-2-nitrobenzene.
| Compound Name | 5-fluoro-1-methyl-2-nitro-3-phenylmethoxybenzene;1,3,5-trifluoro-2-nitrobenzene |
|---|---|
| PubChem CID | 158475219 |
| Molecular Formula | C20H14F4N2O5 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 5-fluoro-1-methyl-2-nitro-3-phenylmethoxybenzene;1,3,5-trifluoro-2-nitrobenzene |
| SMILES | Cc1cc(F)cc(OCc2ccccc2)c1[N+](=O)[O-].O=[N+]([O-])c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H12FNO3.C6H2F3NO2/c1-10-7-12(15)8-13(14(10)16(17)18)19-9-11-5-3-2-4-6-11;7-3-1-4(8)6(10(11)12)5(9)2-3/h2-8H,9H2,1H3;1-2H |
| InChIKey | HGVSOZNZRYEFKP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|