C14H15ClF2O2S — CID 139701777
S-(5-carbonochloridoyl-2,4-difluorophenyl) 4,4-dimethylpentanethioate (PubChem CID 139701777) has the molecular formula C14H15ClF2O2S and a molecular weight of 320.79 g/mol. Its IUPAC name is S-(5-carbonochloridoyl-2,4-difluorophenyl) 4,4-dimethylpentanethioate.
| Compound Name | S-(5-carbonochloridoyl-2,4-difluorophenyl) 4,4-dimethylpentanethioate |
|---|---|
| PubChem CID | 139701777 |
| Molecular Formula | C14H15ClF2O2S |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | S-(5-carbonochloridoyl-2,4-difluorophenyl) 4,4-dimethylpentanethioate |
| SMILES | CC(C)(C)CCC(=O)Sc1cc(C(=O)Cl)c(F)cc1F |
| InChI | InChI=1S/C14H15ClF2O2S/c1-14(2,3)5-4-12(18)20-11-6-8(13(15)19)9(16)7-10(11)17/h6-7H,4-5H2,1-3H3 |
| InChIKey | ZMMUBALOSRELBO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|