C14H15ClF2O3S — CID 139689352
ethyl 2-(5-carbonochloridoyl-2,4-difluorophenyl)sulfanyl-3-methylbutanoate (PubChem CID 139689352) has the molecular formula C14H15ClF2O3S and a molecular weight of 336.79 g/mol. Its IUPAC name is ethyl 2-(5-carbonochloridoyl-2,4-difluorophenyl)sulfanyl-3-methylbutanoate.
| Compound Name | ethyl 2-(5-carbonochloridoyl-2,4-difluorophenyl)sulfanyl-3-methylbutanoate |
|---|---|
| PubChem CID | 139689352 |
| Molecular Formula | C14H15ClF2O3S |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | ethyl 2-(5-carbonochloridoyl-2,4-difluorophenyl)sulfanyl-3-methylbutanoate |
| SMILES | CCOC(=O)C(Sc1cc(C(=O)Cl)c(F)cc1F)C(C)C |
| InChI | InChI=1S/C14H15ClF2O3S/c1-4-20-14(19)12(7(2)3)21-11-5-8(13(15)18)9(16)6-10(11)17/h5-7,12H,4H2,1-3H3 |
| InChIKey | KXJSJLMYOGYCHA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|