C9H14N4O2S — CID 60589152
ethyl 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoate (PubChem CID 60589152) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is ethyl 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoate.
| Compound Name | ethyl 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 60589152 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | ethyl 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoate |
| SMILES | CCOC(=O)C(C)Sc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C9H14N4O2S/c1-3-15-8(14)5(2)16-9-12-6(10)4-7(11)13-9/h4-5H,3H2,1-2H3,(H4,10,11,12,13) |
| InChIKey | JLVREXXVZLHNNV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |