C11H19N5OS — CID 60718365
N-butyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanamide (PubChem CID 60718365) has the molecular formula C11H19N5OS and a molecular weight of 269.37 g/mol. Its IUPAC name is N-butyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | N-butyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 60718365 |
| Molecular Formula | C11H19N5OS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-butyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanamide |
| SMILES | CCCCNC(=O)C(C)Sc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C11H19N5OS/c1-3-4-5-14-10(17)7(2)18-11-15-8(12)6-9(13)16-11/h6-7H,3-5H2,1-2H3,(H,14,17)(H4,12,13,15,16) |
| InChIKey | WVDUPOFDZZRNSF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|