C14H15N5O3S — CID 23886491
4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoylamino]benzoic acid (PubChem CID 23886491) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoylamino]benzoic acid.
| Compound Name | 4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 23886491 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoylamino]benzoic acid |
| SMILES | CC(Sc1nc(N)cc(N)n1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H15N5O3S/c1-7(23-14-18-10(15)6-11(16)19-14)12(20)17-9-4-2-8(3-5-9)13(21)22/h2-7H,1H3,(H,17,20)(H,21,22)(H4,15,16,18,19) |
| InChIKey | BHNAMWZESBROLI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |