C12H14N6OS — CID 112777638
2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-phenylpropanamide (PubChem CID 112777638) has the molecular formula C12H14N6OS and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-phenylpropanamide.
| Compound Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 112777638 |
| Molecular Formula | C12H14N6OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-phenylpropanamide |
| SMILES | CC(Sc1nc(N)nc(N)n1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H14N6OS/c1-7(9(19)15-8-5-3-2-4-6-8)20-12-17-10(13)16-11(14)18-12/h2-7H,1H3,(H,15,19)(H4,13,14,16,17,18) |
| InChIKey | LCRQOEPCKDTDRD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |