C14H13N5OS — CID 865204
(2R)-2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-phenylpropanamide (PubChem CID 865204) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is (2R)-2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-phenylpropanamide.
| Compound Name | (2R)-2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 865204 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (2R)-2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-phenylpropanamide |
| SMILES | C[C@@H](Sc1ncc(C#N)c(N)n1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H13N5OS/c1-9(13(20)18-11-5-3-2-4-6-11)21-14-17-8-10(7-15)12(16)19-14/h2-6,8-9H,1H3,(H,18,20)(H2,16,17,19)/t9-/m1/s1 |
| InChIKey | MBLVCNOEBHFLLS-SECBINFHSA-N |
| XLogP | 2.05 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |