C16H18N4O3S — CID 865445
ethyl 4-amino-2-[(2R)-1-anilino-1-oxopropan-2-yl]sulfanylpyrimidine-5-carboxylate (PubChem CID 865445) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is ethyl 4-amino-2-[(2R)-1-anilino-1-oxopropan-2-yl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[(2R)-1-anilino-1-oxopropan-2-yl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 865445 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | ethyl 4-amino-2-[(2R)-1-anilino-1-oxopropan-2-yl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(S[C@H](C)C(=O)Nc2ccccc2)nc1N |
| InChI | InChI=1S/C16H18N4O3S/c1-3-23-15(22)12-9-18-16(20-13(12)17)24-10(2)14(21)19-11-7-5-4-6-8-11/h4-10H,3H2,1-2H3,(H,19,21)(H2,17,18,20)/t10-/m1/s1 |
| InChIKey | SHGPDHTUCZNOTC-SNVBAGLBSA-N |
| XLogP | 2.35 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |