C13H18N4O3S — CID 78913166
ethyl 4-amino-2-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylpyrimidine-5-carboxylate (PubChem CID 78913166) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is ethyl 4-amino-2-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 78913166 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | ethyl 4-amino-2-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylpyrimidine-5-carboxylate |
| SMILES | C=CCNC(=O)C(C)Sc1ncc(C(=O)OCC)c(N)n1 |
| InChI | InChI=1S/C13H18N4O3S/c1-4-6-15-11(18)8(3)21-13-16-7-9(10(14)17-13)12(19)20-5-2/h4,7-8H,1,5-6H2,2-3H3,(H,15,18)(H2,14,16,17) |
| InChIKey | XDENNPLNMYXVCH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|