C14H15N5OS2 — CID 40789608
(2R)-2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 40789608) has the molecular formula C14H15N5OS2 and a molecular weight of 333.44 g/mol. Its IUPAC name is (2R)-2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | (2R)-2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 40789608 |
| Molecular Formula | C14H15N5OS2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (2R)-2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | C[C@@H](Sc1ncc(C#N)c(N)n1)C(=O)NCCc1cccs1 |
| InChI | InChI=1S/C14H15N5OS2/c1-9(13(20)17-5-4-11-3-2-6-21-11)22-14-18-8-10(7-15)12(16)19-14/h2-3,6,8-9H,4-5H2,1H3,(H,17,20)(H2,16,18,19)/t9-/m1/s1 |
| InChIKey | YRRZEQMDZMKBDC-SECBINFHSA-N |
| XLogP | 1.83 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |