C20H17N5OS2 — CID 46629914
2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-phenylsulfanylphenyl)propanamide (PubChem CID 46629914) has the molecular formula C20H17N5OS2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-phenylsulfanylphenyl)propanamide.
| Compound Name | 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-phenylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 46629914 |
| Molecular Formula | C20H17N5OS2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-phenylsulfanylphenyl)propanamide |
| SMILES | CC(Sc1ncc(C#N)c(N)n1)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C20H17N5OS2/c1-13(27-20-23-12-14(11-21)18(22)25-20)19(26)24-16-9-5-6-10-17(16)28-15-7-3-2-4-8-15/h2-10,12-13H,1H3,(H,24,26)(H2,22,23,25) |
| InChIKey | AEZUHWNYXMNADZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |