C7H12N6OS — CID 63581279
2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanehydrazide (PubChem CID 63581279) has the molecular formula C7H12N6OS and a molecular weight of 228.28 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanehydrazide.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanehydrazide |
|---|---|
| PubChem CID | 63581279 |
| Molecular Formula | C7H12N6OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanehydrazide |
| SMILES | CC(Sc1nc(N)cc(N)n1)C(=O)NN |
| InChI | InChI=1S/C7H12N6OS/c1-3(6(14)13-10)15-7-11-4(8)2-5(9)12-7/h2-3H,10H2,1H3,(H,13,14)(H4,8,9,11,12) |
| InChIKey | ULSDSULYTCTKHM-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|