C9H15N5OS — CID 60665444
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-ethylpropanamide (PubChem CID 60665444) has the molecular formula C9H15N5OS and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-ethylpropanamide.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-ethylpropanamide |
|---|---|
| PubChem CID | 60665444 |
| Molecular Formula | C9H15N5OS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)Sc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C9H15N5OS/c1-3-12-8(15)5(2)16-9-13-6(10)4-7(11)14-9/h4-5H,3H2,1-2H3,(H,12,15)(H4,10,11,13,14) |
| InChIKey | HYPQTFBOUBJNCN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |