C20H29ClFNO3S — CID 139701645
tert-butyl 2-[2-chloro-4-fluoro-5-(2-methylpentanoylamino)phenyl]sulfanylbutanoate (PubChem CID 139701645) has the molecular formula C20H29ClFNO3S and a molecular weight of 417.97 g/mol. Its IUPAC name is tert-butyl 2-[2-chloro-4-fluoro-5-(2-methylpentanoylamino)phenyl]sulfanylbutanoate.
| Compound Name | tert-butyl 2-[2-chloro-4-fluoro-5-(2-methylpentanoylamino)phenyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 139701645 |
| Molecular Formula | C20H29ClFNO3S |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | tert-butyl 2-[2-chloro-4-fluoro-5-(2-methylpentanoylamino)phenyl]sulfanylbutanoate |
| SMILES | CCCC(C)C(=O)Nc1cc(SC(CC)C(=O)OC(C)(C)C)c(Cl)cc1F |
| InChI | InChI=1S/C20H29ClFNO3S/c1-7-9-12(3)18(24)23-15-11-17(13(21)10-14(15)22)27-16(8-2)19(25)26-20(4,5)6/h10-12,16H,7-9H2,1-6H3,(H,23,24) |
| InChIKey | RSOMOEQWEGIUBI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |