C18H25F2NO3S — CID 139689753
tert-butyl 2-[5-(butanoylamino)-2,4-difluorophenyl]sulfanylbutanoate (PubChem CID 139689753) has the molecular formula C18H25F2NO3S and a molecular weight of 373.47 g/mol. Its IUPAC name is tert-butyl 2-[5-(butanoylamino)-2,4-difluorophenyl]sulfanylbutanoate.
| Compound Name | tert-butyl 2-[5-(butanoylamino)-2,4-difluorophenyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 139689753 |
| Molecular Formula | C18H25F2NO3S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | tert-butyl 2-[5-(butanoylamino)-2,4-difluorophenyl]sulfanylbutanoate |
| SMILES | CCCC(=O)Nc1cc(SC(CC)C(=O)OC(C)(C)C)c(F)cc1F |
| InChI | InChI=1S/C18H25F2NO3S/c1-6-8-16(22)21-13-10-15(12(20)9-11(13)19)25-14(7-2)17(23)24-18(3,4)5/h9-10,14H,6-8H2,1-5H3,(H,21,22) |
| InChIKey | UUMMQJQUORWFNU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |