C21H31ClFNO3S — CID 139701345
butyl 2-[2-chloro-4-fluoro-5-(hexanoylamino)phenyl]sulfanylpentanoate (PubChem CID 139701345) has the molecular formula C21H31ClFNO3S and a molecular weight of 432.00 g/mol. Its IUPAC name is butyl 2-[2-chloro-4-fluoro-5-(hexanoylamino)phenyl]sulfanylpentanoate.
| Compound Name | butyl 2-[2-chloro-4-fluoro-5-(hexanoylamino)phenyl]sulfanylpentanoate |
|---|---|
| PubChem CID | 139701345 |
| Molecular Formula | C21H31ClFNO3S |
| Molecular Weight | 432.00 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | butyl 2-[2-chloro-4-fluoro-5-(hexanoylamino)phenyl]sulfanylpentanoate |
| SMILES | CCCCCC(=O)Nc1cc(SC(CCC)C(=O)OCCCC)c(Cl)cc1F |
| InChI | InChI=1S/C21H31ClFNO3S/c1-4-7-9-11-20(25)24-17-14-19(15(22)13-16(17)23)28-18(10-6-3)21(26)27-12-8-5-2/h13-14,18H,4-12H2,1-3H3,(H,24,25) |
| InChIKey | OFRASWOVPJMFAI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.00 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|