C17H23ClFNO2S — CID 139701655
O-propan-2-yl 2-[2-chloro-5-(2,3-dimethylbutanoylamino)-4-fluorophenyl]ethanethioate (PubChem CID 139701655) has the molecular formula C17H23ClFNO2S and a molecular weight of 359.89 g/mol. Its IUPAC name is O-propan-2-yl 2-[2-chloro-5-(2,3-dimethylbutanoylamino)-4-fluorophenyl]ethanethioate.
| Compound Name | O-propan-2-yl 2-[2-chloro-5-(2,3-dimethylbutanoylamino)-4-fluorophenyl]ethanethioate |
|---|---|
| PubChem CID | 139701655 |
| Molecular Formula | C17H23ClFNO2S |
| Molecular Weight | 359.89 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | O-propan-2-yl 2-[2-chloro-5-(2,3-dimethylbutanoylamino)-4-fluorophenyl]ethanethioate |
| SMILES | CC(C)OC(=S)Cc1cc(NC(=O)C(C)C(C)C)c(F)cc1Cl |
| InChI | InChI=1S/C17H23ClFNO2S/c1-9(2)11(5)17(21)20-15-6-12(13(18)8-14(15)19)7-16(23)22-10(3)4/h6,8-11H,7H2,1-5H3,(H,20,21) |
| InChIKey | HPLRPIIINOEENV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.89 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|