C18H16F3NO2S — CID 139689777
O-propan-2-yl 2-[2,4-difluoro-5-[(3-fluorobenzoyl)amino]phenyl]ethanethioate (PubChem CID 139689777) has the molecular formula C18H16F3NO2S and a molecular weight of 367.39 g/mol. Its IUPAC name is O-propan-2-yl 2-[2,4-difluoro-5-[(3-fluorobenzoyl)amino]phenyl]ethanethioate.
| Compound Name | O-propan-2-yl 2-[2,4-difluoro-5-[(3-fluorobenzoyl)amino]phenyl]ethanethioate |
|---|---|
| PubChem CID | 139689777 |
| Molecular Formula | C18H16F3NO2S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | O-propan-2-yl 2-[2,4-difluoro-5-[(3-fluorobenzoyl)amino]phenyl]ethanethioate |
| SMILES | CC(C)OC(=S)Cc1cc(NC(=O)c2cccc(F)c2)c(F)cc1F |
| InChI | InChI=1S/C18H16F3NO2S/c1-10(2)24-17(25)8-12-7-16(15(21)9-14(12)20)22-18(23)11-4-3-5-13(19)6-11/h3-7,9-10H,8H2,1-2H3,(H,22,23) |
| InChIKey | HIXFQNOHVUXDCL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|