C18H25ClFNO2S — CID 139701581
O-tert-butyl 2-[2-chloro-5-(2,2-dimethylbutanoylamino)-4-fluorophenyl]ethanethioate (PubChem CID 139701581) has the molecular formula C18H25ClFNO2S and a molecular weight of 373.92 g/mol. Its IUPAC name is O-tert-butyl 2-[2-chloro-5-(2,2-dimethylbutanoylamino)-4-fluorophenyl]ethanethioate.
| Compound Name | O-tert-butyl 2-[2-chloro-5-(2,2-dimethylbutanoylamino)-4-fluorophenyl]ethanethioate |
|---|---|
| PubChem CID | 139701581 |
| Molecular Formula | C18H25ClFNO2S |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | O-tert-butyl 2-[2-chloro-5-(2,2-dimethylbutanoylamino)-4-fluorophenyl]ethanethioate |
| SMILES | CCC(C)(C)C(=O)Nc1cc(CC(=S)OC(C)(C)C)c(Cl)cc1F |
| InChI | InChI=1S/C18H25ClFNO2S/c1-7-18(5,6)16(22)21-14-8-11(12(19)10-13(14)20)9-15(24)23-17(2,3)4/h8,10H,7,9H2,1-6H3,(H,21,22) |
| InChIKey | BEDLFPGBIWMEHX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|