C15H19ClFNO2S — CID 139689738
O-propan-2-yl 2-[2-chloro-4-fluoro-5-(2-methylpropanoylamino)phenyl]ethanethioate (PubChem CID 139689738) has the molecular formula C15H19ClFNO2S and a molecular weight of 331.84 g/mol. Its IUPAC name is O-propan-2-yl 2-[2-chloro-4-fluoro-5-(2-methylpropanoylamino)phenyl]ethanethioate.
| Compound Name | O-propan-2-yl 2-[2-chloro-4-fluoro-5-(2-methylpropanoylamino)phenyl]ethanethioate |
|---|---|
| PubChem CID | 139689738 |
| Molecular Formula | C15H19ClFNO2S |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | O-propan-2-yl 2-[2-chloro-4-fluoro-5-(2-methylpropanoylamino)phenyl]ethanethioate |
| SMILES | CC(C)OC(=S)Cc1cc(NC(=O)C(C)C)c(F)cc1Cl |
| InChI | InChI=1S/C15H19ClFNO2S/c1-8(2)15(19)18-13-5-10(11(16)7-12(13)17)6-14(21)20-9(3)4/h5,7-9H,6H2,1-4H3,(H,18,19) |
| InChIKey | QHYPNKUVSVBYDF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|