C16H21ClFNO2S — CID 139701546
O-ethyl 2-[2-chloro-4-fluoro-5-(4-methylpentanoylamino)phenyl]ethanethioate (PubChem CID 139701546) has the molecular formula C16H21ClFNO2S and a molecular weight of 345.87 g/mol. Its IUPAC name is O-ethyl 2-[2-chloro-4-fluoro-5-(4-methylpentanoylamino)phenyl]ethanethioate.
| Compound Name | O-ethyl 2-[2-chloro-4-fluoro-5-(4-methylpentanoylamino)phenyl]ethanethioate |
|---|---|
| PubChem CID | 139701546 |
| Molecular Formula | C16H21ClFNO2S |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | O-ethyl 2-[2-chloro-4-fluoro-5-(4-methylpentanoylamino)phenyl]ethanethioate |
| SMILES | CCOC(=S)Cc1cc(NC(=O)CCC(C)C)c(F)cc1Cl |
| InChI | InChI=1S/C16H21ClFNO2S/c1-4-21-16(22)8-11-7-14(13(18)9-12(11)17)19-15(20)6-5-10(2)3/h7,9-10H,4-6,8H2,1-3H3,(H,19,20) |
| InChIKey | LRRHMYGPKQOPHY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|