C10H11BrF2N2O — CID 107611740
4-amino-N-(4-bromo-2,5-difluorophenyl)butanamide (PubChem CID 107611740) has the molecular formula C10H11BrF2N2O and a molecular weight of 293.11 g/mol. Its IUPAC name is 4-amino-N-(4-bromo-2,5-difluorophenyl)butanamide.
| Compound Name | 4-amino-N-(4-bromo-2,5-difluorophenyl)butanamide |
|---|---|
| PubChem CID | 107611740 |
| Molecular Formula | C10H11BrF2N2O |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 4-amino-N-(4-bromo-2,5-difluorophenyl)butanamide |
| SMILES | NCCCC(=O)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C10H11BrF2N2O/c11-6-4-8(13)9(5-7(6)12)15-10(16)2-1-3-14/h4-5H,1-3,14H2,(H,15,16) |
| InChIKey | HGZAMHNZRMHHMH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|