C11H11BrClF2NO — CID 102853254
N-(5-bromo-2,4-difluorophenyl)-5-chloropentanamide (PubChem CID 102853254) has the molecular formula C11H11BrClF2NO and a molecular weight of 326.57 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-5-chloropentanamide.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-5-chloropentanamide |
|---|---|
| PubChem CID | 102853254 |
| Molecular Formula | C11H11BrClF2NO |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-5-chloropentanamide |
| SMILES | O=C(CCCCCl)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C11H11BrClF2NO/c12-7-5-10(9(15)6-8(7)14)16-11(17)3-1-2-4-13/h5-6H,1-4H2,(H,16,17) |
| InChIKey | IMCYSBPQTKDWPU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|