C14H16BrF2NO3 — CID 106812324
tert-butyl 4-(4-bromo-2,5-difluoroanilino)-4-oxobutanoate (PubChem CID 106812324) has the molecular formula C14H16BrF2NO3 and a molecular weight of 364.19 g/mol. Its IUPAC name is tert-butyl 4-(4-bromo-2,5-difluoroanilino)-4-oxobutanoate.
| Compound Name | tert-butyl 4-(4-bromo-2,5-difluoroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 106812324 |
| Molecular Formula | C14H16BrF2NO3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | tert-butyl 4-(4-bromo-2,5-difluoroanilino)-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C14H16BrF2NO3/c1-14(2,3)21-13(20)5-4-12(19)18-11-7-9(16)8(15)6-10(11)17/h6-7H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | QBIYZACGLNSUDR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|