C12H13BrFNO3 — CID 164544890
ethyl N-[2-(4-bromo-2-fluoro-5-methylphenyl)acetyl]carbamate (PubChem CID 164544890) has the molecular formula C12H13BrFNO3 and a molecular weight of 318.14 g/mol. Its IUPAC name is ethyl N-[2-(4-bromo-2-fluoro-5-methylphenyl)acetyl]carbamate.
| Compound Name | ethyl N-[2-(4-bromo-2-fluoro-5-methylphenyl)acetyl]carbamate |
|---|---|
| PubChem CID | 164544890 |
| Molecular Formula | C12H13BrFNO3 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | ethyl N-[2-(4-bromo-2-fluoro-5-methylphenyl)acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)Cc1cc(C)c(Br)cc1F |
| InChI | InChI=1S/C12H13BrFNO3/c1-3-18-12(17)15-11(16)5-8-4-7(2)9(13)6-10(8)14/h4,6H,3,5H2,1-2H3,(H,15,16,17) |
| InChIKey | UCTJBSIGBNHZBA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |