C10H11F3INO2 — CID 175284509
ethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate;hydroiodide (PubChem CID 175284509) has the molecular formula C10H11F3INO2 and a molecular weight of 361.10 g/mol. Its IUPAC name is ethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate;hydroiodide.
| Compound Name | ethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 175284509 |
| Molecular Formula | C10H11F3INO2 |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | ethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate;hydroiodide |
| SMILES | CCOC(=O)NCc1cc(F)c(F)cc1F.I |
| InChI | InChI=1S/C10H10F3NO2.HI/c1-2-16-10(15)14-5-6-3-8(12)9(13)4-7(6)11;/h3-4H,2,5H2,1H3,(H,14,15);1H |
| InChIKey | PQRZFCLJKUAPNJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|