C22H32N2O6 — CID 101292354
ethyl N-[[2,4-bis(2-ethenoxyethyl)-5-[(ethoxycarbonylamino)methyl]phenyl]methyl]carbamate (PubChem CID 101292354) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is ethyl N-[[2,4-bis(2-ethenoxyethyl)-5-[(ethoxycarbonylamino)methyl]phenyl]methyl]carbamate.
| Compound Name | ethyl N-[[2,4-bis(2-ethenoxyethyl)-5-[(ethoxycarbonylamino)methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 101292354 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | ethyl N-[[2,4-bis(2-ethenoxyethyl)-5-[(ethoxycarbonylamino)methyl]phenyl]methyl]carbamate |
| SMILES | C=COCCc1cc(CCOC=C)c(CNC(=O)OCC)cc1CNC(=O)OCC |
| InChI | InChI=1S/C22H32N2O6/c1-5-27-11-9-17-13-18(10-12-28-6-2)20(16-24-22(26)30-8-4)14-19(17)15-23-21(25)29-7-3/h5-6,13-14H,1-2,7-12,15-16H2,3-4H3,(H,23,25)(H,24,26) |
| InChIKey | PNZKVESOFDYFGB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|