C24H36N2O6 — CID 101292360
ethyl N-[[3-[(ethoxycarbonylamino)methyl]-4,5-bis(2-prop-2-enoxyethyl)phenyl]methyl]carbamate (PubChem CID 101292360) has the molecular formula C24H36N2O6 and a molecular weight of 448.56 g/mol. Its IUPAC name is ethyl N-[[3-[(ethoxycarbonylamino)methyl]-4,5-bis(2-prop-2-enoxyethyl)phenyl]methyl]carbamate.
| Compound Name | ethyl N-[[3-[(ethoxycarbonylamino)methyl]-4,5-bis(2-prop-2-enoxyethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 101292360 |
| Molecular Formula | C24H36N2O6 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | ethyl N-[[3-[(ethoxycarbonylamino)methyl]-4,5-bis(2-prop-2-enoxyethyl)phenyl]methyl]carbamate |
| SMILES | C=CCOCCc1cc(CNC(=O)OCC)cc(CNC(=O)OCC)c1CCOCC=C |
| InChI | InChI=1S/C24H36N2O6/c1-5-11-29-13-9-20-15-19(17-25-23(27)31-7-3)16-21(18-26-24(28)32-8-4)22(20)10-14-30-12-6-2/h5-6,15-16H,1-2,7-14,17-18H2,3-4H3,(H,25,27)(H,26,28) |
| InChIKey | DMNXYVWMHPFWOF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|