C15H20N2O4 — CID 123602498
prop-2-enyl N-[[4-[(3-amino-3-oxopropoxy)methyl]phenyl]methyl]carbamate (PubChem CID 123602498) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is prop-2-enyl N-[[4-[(3-amino-3-oxopropoxy)methyl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[4-[(3-amino-3-oxopropoxy)methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 123602498 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | prop-2-enyl N-[[4-[(3-amino-3-oxopropoxy)methyl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1ccc(COCCC(N)=O)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-2-8-21-15(19)17-10-12-3-5-13(6-4-12)11-20-9-7-14(16)18/h2-6H,1,7-11H2,(H2,16,18)(H,17,19) |
| InChIKey | HTZOHTOHHATCHD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|